C17H10ClNO2 — CID 122194424
3-chloro-5-methylindeno[2,1-b]quinoline-6,11-dione (PubChem CID 122194424) has the molecular formula C17H10ClNO2 and a molecular weight of 295.73 g/mol. Its IUPAC name is 3-chloro-5-methylindeno[2,1-b]quinoline-6,11-dione.
| Compound Name | 3-chloro-5-methylindeno[2,1-b]quinoline-6,11-dione |
|---|---|
| PubChem CID | 122194424 |
| Molecular Formula | C17H10ClNO2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-chloro-5-methylindeno[2,1-b]quinoline-6,11-dione |
| SMILES | Cn1c2c(c(=O)c3ccc(Cl)cc31)-c1ccccc1C2=O |
| InChI | InChI=1S/C17H10ClNO2/c1-19-13-8-9(18)6-7-12(13)16(20)14-10-4-2-3-5-11(10)17(21)15(14)19/h2-8H,1H3 |
| InChIKey | KYLVMDJXJPCWJF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |