C31H24Cl2N4O7S — CID 122194475
(2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(4S)-4-[[4-(4-chlorophenyl)phenyl]methyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanamide (PubChem CID 122194475) has the molecular formula C31H24Cl2N4O7S and a molecular weight of 667.53 g/mol. Its IUPAC name is (2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(4S)-4-[[4-(4-chlorophenyl)phenyl]methyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanamide.
| Compound Name | (2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(4S)-4-[[4-(4-chlorophenyl)phenyl]methyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 122194475 |
| Molecular Formula | C31H24Cl2N4O7S |
| Molecular Weight | 667.53 g/mol |
| Exact Mass | 666.07 |
| IUPAC Name | (2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(4S)-4-[[4-(4-chlorophenyl)phenyl]methyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1)[C@H](Cc1ccccc1)N1C(=O)N[C@@H](Cc2ccc(-c3ccc(Cl)cc3)cc2)C1=O |
| InChI | InChI=1S/C31H24Cl2N4O7S/c32-23-12-10-22(11-13-23)21-8-6-20(7-9-21)16-26-30(39)36(31(40)34-26)28(17-19-4-2-1-3-5-19)29(38)35-45(43,44)24-14-15-25(33)27(18-24)37(41)42/h1-15,18,26,28H,16-17H2,(H,34,40)(H,35,38)/t26-,28-/m0/s1 |
| InChIKey | OQKABKQHXVJGKK-XCZPVHLTSA-N |
| XLogP | 5.15 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|