C32H54N4O4 — CID 122194560
N-[(2S)-3-cyclohexyl-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-1-oxopropan-2-yl]decanamide (PubChem CID 122194560) has the molecular formula C32H54N4O4 and a molecular weight of 558.81 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-1-oxopropan-2-yl]decanamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-1-oxopropan-2-yl]decanamide |
|---|---|
| PubChem CID | 122194560 |
| Molecular Formula | C32H54N4O4 |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.41 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-1-oxopropan-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H]1/C=C/CCNC(=O)/C=C/[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C32H54N4O4/c1-4-5-6-7-8-9-13-19-30(38)34-28(23-25-16-11-10-12-17-25)32(40)36-27-18-14-15-22-33-29(37)21-20-26(24(2)3)35-31(27)39/h14,18,20-21,24-28H,4-13,15-17,19,22-23H2,1-3H3,(H,33,37)(H,34,38)(H,35,39)(H,36,40)/b18-14+,21-20+/t26-,27+,28+/m1/s1 |
| InChIKey | BKFUCZOPISPECH-AXYLIBAESA-N |
| XLogP | 4.84 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|