C21H32O3 — CID 122194616
tert-butyl (E)-3-[(1R,4aS,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]prop-2-enoate (PubChem CID 122194616) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is tert-butyl (E)-3-[(1R,4aS,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[(1R,4aS,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 122194616 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | tert-butyl (E)-3-[(1R,4aS,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/C1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C=O |
| InChI | InChI=1S/C21H32O3/c1-19(2,3)24-18(23)11-9-15-8-10-17-20(4,5)12-7-13-21(17,6)16(15)14-22/h8-9,11,14,16-17H,7,10,12-13H2,1-6H3/b11-9+/t16-,17-,21+/m0/s1 |
| InChIKey | MERRKBBALWEHIV-GPRPILCGSA-N |
| XLogP | 4.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|