C20H28O3 — CID 122194618
methyl (2E,4E)-5-[(1R,4aS,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]penta-2,4-dienoate (PubChem CID 122194618) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is methyl (2E,4E)-5-[(1R,4aS,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]penta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-[(1R,4aS,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 122194618 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | methyl (2E,4E)-5-[(1R,4aS,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]penta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/C1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C=O |
| InChI | InChI=1S/C20H28O3/c1-19(2)12-7-13-20(3)16(14-21)15(10-11-17(19)20)8-5-6-9-18(22)23-4/h5-6,8-10,14,16-17H,7,11-13H2,1-4H3/b8-5+,9-6+/t16-,17-,20+/m0/s1 |
| InChIKey | KIUSDWAFBLEKJH-NQASQMSKSA-N |
| XLogP | 4.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|