C15H13FO3 — CID 122194751
8-fluoro-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione (PubChem CID 122194751) has the molecular formula C15H13FO3 and a molecular weight of 260.26 g/mol. Its IUPAC name is 8-fluoro-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione.
| Compound Name | 8-fluoro-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
|---|---|
| PubChem CID | 122194751 |
| Molecular Formula | C15H13FO3 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 8-fluoro-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
| SMILES | CC1(C)CCC2=C(O1)c1ccc(F)cc1C(=O)C2=O |
| InChI | InChI=1S/C15H13FO3/c1-15(2)6-5-10-12(17)13(18)11-7-8(16)3-4-9(11)14(10)19-15/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | NLISVJXCSAFEBY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|