About 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine
3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine (PubChem CID 122194936) has the molecular formula C6H9FN4
and a molecular weight of 155.17 g/mol. Its IUPAC name is 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine.
Molecular Properties
| Compound Name | 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine |
| PubChem CID | 122194936 |
| Molecular Formula | C6H9FN4 |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine |
| SMILES | Cc1nnc(CCC[18F])nn1 |
| InChI | InChI=1S/C6H9FN4/c1-5-8-10-6(11-9-5)3-2-4-7/h2-4H2,1H3/i7-1 |
| InChIKey | NHBHZXUDOLZBOY-JZRMKITLSA-N |
| XLogP | 0.48 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine?
The IUPAC name of 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine (CID 122194936) is 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine.
What is the SMILES notation for 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine?
The canonical SMILES for 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine is Cc1nnc(CCC[18F])nn1.
What is the InChIKey of 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine?
The InChIKey is NHBHZXUDOLZBOY-JZRMKITLSA-N. The full InChI is InChI=1S/C6H9FN4/c1-5-8-10-6(11-9-5)3-2-4-7/h2-4H2,1H3/i7-1.
What are the key properties of 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine?
3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine has a molecular weight of 155.17 g/mol, XLogP of 0.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-(18F)fluoropropyl)-6-methyl-1,2,4,5-tetrazine is sourced from PubChem (CID 122194936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).