C36H65ClN2O5 — CID 122195007
(2S,4S,5S,7S)-5-amino-N-(3-cyclohexyl-2,2-dimethylpropyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide;hydrochloride (PubChem CID 122195007) has the molecular formula C36H65ClN2O5 and a molecular weight of 641.38 g/mol. Its IUPAC name is (2S,4S,5S,7S)-5-amino-N-(3-cyclohexyl-2,2-dimethylpropyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide;hydrochloride.
| Compound Name | (2S,4S,5S,7S)-5-amino-N-(3-cyclohexyl-2,2-dimethylpropyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide;hydrochloride |
|---|---|
| PubChem CID | 122195007 |
| Molecular Formula | C36H65ClN2O5 |
| Molecular Weight | 641.38 g/mol |
| Exact Mass | 640.46 |
| IUPAC Name | (2S,4S,5S,7S)-5-amino-N-(3-cyclohexyl-2,2-dimethylpropyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide;hydrochloride |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)NCC(C)(C)CC2CCCCC2)C(C)C)C(C)C)ccc1OC.Cl |
| InChI | InChI=1S/C36H64N2O5.ClH/c1-25(2)29(19-28-15-16-33(42-8)34(20-28)43-18-12-17-41-7)21-31(37)32(39)22-30(26(3)4)35(40)38-24-36(5,6)23-27-13-10-9-11-14-27;/h15-16,20,25-27,29-32,39H,9-14,17-19,21-24,37H2,1-8H3,(H,38,40);1H/t29-,30-,31-,32-;/m0./s1 |
| InChIKey | DQCCDOVMMZAYNZ-WYDLTDSDSA-N |
| XLogP | 7.20 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.38 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|