C26H22N2O4S — CID 122195313
7-[4-(1,3-benzothiazol-2-ylamino)butoxy]-5-hydroxy-2-phenylchromen-4-one (PubChem CID 122195313) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is 7-[4-(1,3-benzothiazol-2-ylamino)butoxy]-5-hydroxy-2-phenylchromen-4-one.
| Compound Name | 7-[4-(1,3-benzothiazol-2-ylamino)butoxy]-5-hydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 122195313 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 7-[4-(1,3-benzothiazol-2-ylamino)butoxy]-5-hydroxy-2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(OCCCCNc3nc4ccccc4s3)cc(O)c12 |
| InChI | InChI=1S/C26H22N2O4S/c29-20-14-18(15-23-25(20)21(30)16-22(32-23)17-8-2-1-3-9-17)31-13-7-6-12-27-26-28-19-10-4-5-11-24(19)33-26/h1-5,8-11,14-16,29H,6-7,12-13H2,(H,27,28) |
| InChIKey | QSWGEPJUHUHYFF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|