About 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one
7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one (PubChem CID 122195316) has the molecular formula C28H26N2O5S
and a molecular weight of 502.59 g/mol. Its IUPAC name is 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one |
| PubChem CID | 122195316 |
| Molecular Formula | C28H26N2O5S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one |
| SMILES | CCOc1ccc2nc(NCCCCOc3cc(O)c4c(=O)cc(-c5ccccc5)oc4c3)sc2c1 |
| InChI | InChI=1S/C28H26N2O5S/c1-2-33-19-10-11-21-26(16-19)36-28(30-21)29-12-6-7-13-34-20-14-22(31)27-23(32)17-24(35-25(27)15-20)18-8-4-3-5-9-18/h3-5,8-11,14-17,31H,2,6-7,12-13H2,1H3,(H,29,30) |
| InChIKey | GFEFEHXJNMIHBR-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one?
The IUPAC name of 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one (CID 122195316) is 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one.
What is the SMILES notation for 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one?
The canonical SMILES for 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one is CCOc1ccc2nc(NCCCCOc3cc(O)c4c(=O)cc(-c5ccccc5)oc4c3)sc2c1.
What is the InChIKey of 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one?
The InChIKey is GFEFEHXJNMIHBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O5S/c1-2-33-19-10-11-21-26(16-19)36-28(30-21)29-12-6-7-13-34-20-14-22(31)27-23(32)17-24(35-25(27)15-20)18-8-4-3-5-9-18/h3-5,8-11,14-17,31H,2,6-7,12-13H2,1H3,(H,29,30).
What are the key properties of 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one?
7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one has a molecular weight of 502.59 g/mol, XLogP of 6.45, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one is sourced from PubChem (CID 122195316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).