About 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one
7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one (PubChem CID 122195327) has the molecular formula C28H24N2O5S
and a molecular weight of 500.58 g/mol. Its IUPAC name is 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one |
| PubChem CID | 122195327 |
| Molecular Formula | C28H24N2O5S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one |
| SMILES | CC(=O)c1ccc2nc(NCCCCOc3cc(O)c4c(=O)cc(-c5ccccc5)oc4c3)sc2c1 |
| InChI | InChI=1S/C28H24N2O5S/c1-17(31)19-9-10-21-26(13-19)36-28(30-21)29-11-5-6-12-34-20-14-22(32)27-23(33)16-24(35-25(27)15-20)18-7-3-2-4-8-18/h2-4,7-10,13-16,32H,5-6,11-12H2,1H3,(H,29,30) |
| InChIKey | FKLUFLSAJRZTLO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one?
The IUPAC name of 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one (CID 122195327) is 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one.
What is the SMILES notation for 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one?
The canonical SMILES for 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one is CC(=O)c1ccc2nc(NCCCCOc3cc(O)c4c(=O)cc(-c5ccccc5)oc4c3)sc2c1.
What is the InChIKey of 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one?
The InChIKey is FKLUFLSAJRZTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24N2O5S/c1-17(31)19-9-10-21-26(13-19)36-28(30-21)29-11-5-6-12-34-20-14-22(32)27-23(33)16-24(35-25(27)15-20)18-7-3-2-4-8-18/h2-4,7-10,13-16,32H,5-6,11-12H2,1H3,(H,29,30).
What are the key properties of 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one?
7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one has a molecular weight of 500.58 g/mol, XLogP of 6.25, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-[(6-acetyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one is sourced from PubChem (CID 122195327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).