About 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea
1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea (PubChem CID 122195472) has the molecular formula C21H17N5O3
and a molecular weight of 387.40 g/mol. Its IUPAC name is 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea.
Molecular Properties
| Compound Name | 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea |
| PubChem CID | 122195472 |
| Molecular Formula | C21H17N5O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea |
| SMILES | Nc1n[nH]c2cccc(-c3ccc(NC(=O)Nc4ccc5c(c4)OCO5)cc3)c12 |
| InChI | InChI=1S/C21H17N5O3/c22-20-19-15(2-1-3-16(19)25-26-20)12-4-6-13(7-5-12)23-21(27)24-14-8-9-17-18(10-14)29-11-28-17/h1-10H,11H2,(H3,22,25,26)(H2,23,24,27) |
| InChIKey | GWXFTLKHWKDIOO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea?
The IUPAC name of 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea (CID 122195472) is 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea.
What is the SMILES notation for 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea?
The canonical SMILES for 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea is Nc1n[nH]c2cccc(-c3ccc(NC(=O)Nc4ccc5c(c4)OCO5)cc3)c12.
What is the InChIKey of 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea?
The InChIKey is GWXFTLKHWKDIOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N5O3/c22-20-19-15(2-1-3-16(19)25-26-20)12-4-6-13(7-5-12)23-21(27)24-14-8-9-17-18(10-14)29-11-28-17/h1-10H,11H2,(H3,22,25,26)(H2,23,24,27).
What are the key properties of 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea?
1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea has a molecular weight of 387.40 g/mol, XLogP of 4.18, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea is sourced from PubChem (CID 122195472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).