C19H19NO4 — CID 122195657
4-[3-(2-hydroxyethyl)-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-7-yl]phenol (PubChem CID 122195657) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 4-[3-(2-hydroxyethyl)-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-7-yl]phenol.
| Compound Name | 4-[3-(2-hydroxyethyl)-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-7-yl]phenol |
|---|---|
| PubChem CID | 122195657 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-[3-(2-hydroxyethyl)-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazin-7-yl]phenol |
| SMILES | OCCN1COc2cc3c(cc2C1)C=C(c1ccc(O)cc1)CO3 |
| InChI | InChI=1S/C19H19NO4/c21-6-5-20-10-15-7-14-8-16(13-1-3-17(22)4-2-13)11-23-18(14)9-19(15)24-12-20/h1-4,7-9,21-22H,5-6,10-12H2 |
| InChIKey | VCPMAKIOQXWXGJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|