C32H31O5P — CID 122195672
(2R,5R,6R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-5,6-dihydro-1,2λ5-oxaphosphinine 2-oxide (PubChem CID 122195672) has the molecular formula C32H31O5P and a molecular weight of 526.57 g/mol. Its IUPAC name is (2R,5R,6R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-5,6-dihydro-1,2λ5-oxaphosphinine 2-oxide.
| Compound Name | (2R,5R,6R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-5,6-dihydro-1,2λ5-oxaphosphinine 2-oxide |
|---|---|
| PubChem CID | 122195672 |
| Molecular Formula | C32H31O5P |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | (2R,5R,6R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-5,6-dihydro-1,2λ5-oxaphosphinine 2-oxide |
| SMILES | O=[P@]1(c2ccccc2)C=C(OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C32H31O5P/c33-38(29-19-11-4-12-20-29)25-31(35-22-27-15-7-2-8-16-27)32(36-23-28-17-9-3-10-18-28)30(37-38)24-34-21-26-13-5-1-6-14-26/h1-20,25,30,32H,21-24H2/t30-,32-,38-/m1/s1 |
| InChIKey | QYDDCXUJJVGCAB-OJYMKHDISA-N |
| XLogP | 6.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|