About 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea
1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea (PubChem CID 122195814) has the molecular formula C22H15Cl3N4O2
and a molecular weight of 473.75 g/mol. Its IUPAC name is 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea |
| PubChem CID | 122195814 |
| Molecular Formula | C22H15Cl3N4O2 |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1cc2ncncc2cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H15Cl3N4O2/c23-16-4-2-1-3-13(16)11-31-21-7-14-10-26-12-27-19(14)9-20(21)29-22(30)28-15-5-6-17(24)18(25)8-15/h1-10,12H,11H2,(H2,28,29,30) |
| InChIKey | QOTJRZOWKVKEEE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea?
The IUPAC name of 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea (CID 122195814) is 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea.
What is the SMILES notation for 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea?
The canonical SMILES for 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea is O=C(Nc1ccc(Cl)c(Cl)c1)Nc1cc2ncncc2cc1OCc1ccccc1Cl.
What is the InChIKey of 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea?
The InChIKey is QOTJRZOWKVKEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15Cl3N4O2/c23-16-4-2-1-3-13(16)11-31-21-7-14-10-26-12-27-19(14)9-20(21)29-22(30)28-15-5-6-17(24)18(25)8-15/h1-10,12H,11H2,(H2,28,29,30).
What are the key properties of 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea?
1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea has a molecular weight of 473.75 g/mol, XLogP of 6.81, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[(2-chlorophenyl)methoxy]quinazolin-7-yl]-3-(3,4-dichlorophenyl)urea is sourced from PubChem (CID 122195814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).