C12H13F4N3O — CID 122196031
(5R,6R)-5-(5-amino-2-fluorophenyl)-5-methyl-6-(trifluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine (PubChem CID 122196031) has the molecular formula C12H13F4N3O and a molecular weight of 291.25 g/mol. Its IUPAC name is (5R,6R)-5-(5-amino-2-fluorophenyl)-5-methyl-6-(trifluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine.
| Compound Name | (5R,6R)-5-(5-amino-2-fluorophenyl)-5-methyl-6-(trifluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine |
|---|---|
| PubChem CID | 122196031 |
| Molecular Formula | C12H13F4N3O |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (5R,6R)-5-(5-amino-2-fluorophenyl)-5-methyl-6-(trifluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine |
| SMILES | C[C@]1(c2cc(N)ccc2F)N=C(N)CO[C@H]1C(F)(F)F |
| InChI | InChI=1S/C12H13F4N3O/c1-11(7-4-6(17)2-3-8(7)13)10(12(14,15)16)20-5-9(18)19-11/h2-4,10H,5,17H2,1H3,(H2,18,19)/t10-,11-/m1/s1 |
| InChIKey | HJEZMGLZZLYQQZ-GHMZBOCLSA-N |
| XLogP | 1.94 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|