About 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol
2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol (PubChem CID 122196151) has the molecular formula C19H32F5NO2S
and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol |
| PubChem CID | 122196151 |
| Molecular Formula | C19H32F5NO2S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol |
| SMILES | NC(CO)(CO)CCCCCCCCCCc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C19H32F5NO2S/c20-28(21,22,23,24)18-12-10-17(11-13-18)9-7-5-3-1-2-4-6-8-14-19(25,15-26)16-27/h10-13,26-27H,1-9,14-16,25H2 |
| InChIKey | VGOWUWKXGCOTND-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol?
The IUPAC name of 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol (CID 122196151) is 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol.
What is the SMILES notation for 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol?
The canonical SMILES for 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol is NC(CO)(CO)CCCCCCCCCCc1ccc(S(F)(F)(F)(F)F)cc1.
What is the InChIKey of 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol?
The InChIKey is VGOWUWKXGCOTND-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32F5NO2S/c20-28(21,22,23,24)18-12-10-17(11-13-18)9-7-5-3-1-2-4-6-8-14-19(25,15-26)16-27/h10-13,26-27H,1-9,14-16,25H2.
What are the key properties of 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol?
2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol has a molecular weight of 433.53 g/mol, XLogP of 6.08, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[10-[4-(pentafluoro-λ6-sulfanyl)phenyl]decyl]propane-1,3-diol is sourced from PubChem (CID 122196151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).