C24H20F3N5O2 — CID 122196200
N-[2-[[4-(3-amino-1H-indazol-4-yl)benzoyl]amino]ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 122196200) has the molecular formula C24H20F3N5O2 and a molecular weight of 467.45 g/mol. Its IUPAC name is N-[2-[[4-(3-amino-1H-indazol-4-yl)benzoyl]amino]ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[4-(3-amino-1H-indazol-4-yl)benzoyl]amino]ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 122196200 |
| Molecular Formula | C24H20F3N5O2 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-[2-[[4-(3-amino-1H-indazol-4-yl)benzoyl]amino]ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | Nc1n[nH]c2cccc(-c3ccc(C(=O)NCCNC(=O)c4cccc(C(F)(F)F)c4)cc3)c12 |
| InChI | InChI=1S/C24H20F3N5O2/c25-24(26,27)17-4-1-3-16(13-17)23(34)30-12-11-29-22(33)15-9-7-14(8-10-15)18-5-2-6-19-20(18)21(28)32-31-19/h1-10,13H,11-12H2,(H,29,33)(H,30,34)(H3,28,31,32) |
| InChIKey | VXPRMSHSUFWMNM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|