C16H13F3N4OS — CID 122196321
(5Z)-3-methyl-2-methylimino-5-[[1-[2-(trifluoromethyl)phenyl]pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 122196321) has the molecular formula C16H13F3N4OS and a molecular weight of 366.37 g/mol. Its IUPAC name is (5Z)-3-methyl-2-methylimino-5-[[1-[2-(trifluoromethyl)phenyl]pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-methyl-2-methylimino-5-[[1-[2-(trifluoromethyl)phenyl]pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 122196321 |
| Molecular Formula | C16H13F3N4OS |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (5Z)-3-methyl-2-methylimino-5-[[1-[2-(trifluoromethyl)phenyl]pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | C/N=C1/S/C(=C\c2cnn(-c3ccccc3C(F)(F)F)c2)C(=O)N1C |
| InChI | InChI=1S/C16H13F3N4OS/c1-20-15-22(2)14(24)13(25-15)7-10-8-21-23(9-10)12-6-4-3-5-11(12)16(17,18)19/h3-9H,1-2H3/b13-7-,20-15+ |
| InChIKey | KYFWXSAQLMWVNU-BUSRTVQZSA-N |
| XLogP | 3.42 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|