About 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole
2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole (PubChem CID 122196369) has the molecular formula C28H27N3O2S
and a molecular weight of 469.61 g/mol. Its IUPAC name is 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole |
| PubChem CID | 122196369 |
| Molecular Formula | C28H27N3O2S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc(OCCCN4CCC(c5nc6ccccc6s5)CC4)cc3)nc2c1 |
| InChI | InChI=1S/C28H27N3O2S/c1-3-8-25-23(6-1)29-27(33-25)20-10-12-22(13-11-20)32-19-5-16-31-17-14-21(15-18-31)28-30-24-7-2-4-9-26(24)34-28/h1-4,6-13,21H,5,14-19H2 |
| InChIKey | CFVAAXIVOJKSJZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole?
The IUPAC name of 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole (CID 122196369) is 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole?
The canonical SMILES for 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole is c1ccc2oc(-c3ccc(OCCCN4CCC(c5nc6ccccc6s5)CC4)cc3)nc2c1.
What is the InChIKey of 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole?
The InChIKey is CFVAAXIVOJKSJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N3O2S/c1-3-8-25-23(6-1)29-27(33-25)20-10-12-22(13-11-20)32-19-5-16-31-17-14-21(15-18-31)28-30-24-7-2-4-9-26(24)34-28/h1-4,6-13,21H,5,14-19H2.
What are the key properties of 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole?
2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole has a molecular weight of 469.61 g/mol, XLogP of 6.75, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propoxy]phenyl]-1,3-benzoxazole is sourced from PubChem (CID 122196369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).