C25H29NO7 — CID 122196584
(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[[(2Z,9R)-2-[3-(methylamino)propylidene]-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]oxy]oxane-2-carboxylic acid (PubChem CID 122196584) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[[(2Z,9R)-2-[3-(methylamino)propylidene]-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]oxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[[(2Z,9R)-2-[3-(methylamino)propylidene]-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]oxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 122196584 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[[(2Z,9R)-2-[3-(methylamino)propylidene]-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]oxy]oxane-2-carboxylic acid |
| SMILES | CNCC/C=C1/c2ccccc2C[C@@H](OC2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c2ccccc21 |
| InChI | InChI=1S/C25H29NO7/c1-26-12-6-11-16-15-8-3-2-7-14(15)13-19(18-10-5-4-9-17(16)18)32-25-22(29)20(27)21(28)23(33-25)24(30)31/h2-5,7-11,19-23,25-29H,6,12-13H2,1H3,(H,30,31)/b16-11-/t19-,20+,21+,22-,23+,25?/m1/s1 |
| InChIKey | GJSVHHHXSHULEA-AGSOVYPUSA-N |
| XLogP | 1.23 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|