C33H41F3O4 — CID 122197253
(1S,5S,7S)-3-benzoyl-4-methoxy-8,8-dimethyl-1,5-bis(3-methylbut-2-enyl)-7-(4,4,4-trifluorobutyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 122197253) has the molecular formula C33H41F3O4 and a molecular weight of 558.68 g/mol. Its IUPAC name is (1S,5S,7S)-3-benzoyl-4-methoxy-8,8-dimethyl-1,5-bis(3-methylbut-2-enyl)-7-(4,4,4-trifluorobutyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1S,5S,7S)-3-benzoyl-4-methoxy-8,8-dimethyl-1,5-bis(3-methylbut-2-enyl)-7-(4,4,4-trifluorobutyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 122197253 |
| Molecular Formula | C33H41F3O4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | (1S,5S,7S)-3-benzoyl-4-methoxy-8,8-dimethyl-1,5-bis(3-methylbut-2-enyl)-7-(4,4,4-trifluorobutyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | COC1=C(C(=O)c2ccccc2)C(=O)[C@]2(CC=C(C)C)C(=O)[C@@]1(CC=C(C)C)C[C@H](CCCC(F)(F)F)C2(C)C |
| InChI | InChI=1S/C33H41F3O4/c1-21(2)15-18-31-20-24(14-11-17-33(34,35)36)30(5,6)32(29(31)39,19-16-22(3)4)27(38)25(28(31)40-7)26(37)23-12-9-8-10-13-23/h8-10,12-13,15-16,24H,11,14,17-20H2,1-7H3/t24-,31-,32+/m0/s1 |
| InChIKey | OQEMHEPXWZDOPP-JPBRBXQBSA-N |
| XLogP | 8.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|