C35H31Cl2NO5 — CID 122197317
[(2S,4R,6R)-4-chloro-6-naphthalen-1-yloxan-2-yl]methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (PubChem CID 122197317) has the molecular formula C35H31Cl2NO5 and a molecular weight of 616.54 g/mol. Its IUPAC name is [(2S,4R,6R)-4-chloro-6-naphthalen-1-yloxan-2-yl]methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate.
| Compound Name | [(2S,4R,6R)-4-chloro-6-naphthalen-1-yloxan-2-yl]methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 122197317 |
| Molecular Formula | C35H31Cl2NO5 |
| Molecular Weight | 616.54 g/mol |
| Exact Mass | 615.16 |
| IUPAC Name | [(2S,4R,6R)-4-chloro-6-naphthalen-1-yloxan-2-yl]methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| SMILES | COc1ccc2c(c1)c(CC(=O)OC[C@@H]1C[C@H](Cl)C[C@H](c3cccc4ccccc34)O1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H31Cl2NO5/c1-21-30(31-18-26(41-2)14-15-32(31)38(21)35(40)23-10-12-24(36)13-11-23)19-34(39)42-20-27-16-25(37)17-33(43-27)29-9-5-7-22-6-3-4-8-28(22)29/h3-15,18,25,27,33H,16-17,19-20H2,1-2H3/t25-,27-,33+/m0/s1 |
| InChIKey | JKXGMFYYODHUJX-TZTHSTJISA-N |
| XLogP | 8.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.54 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|