C36H44N4O5 — CID 122197352
benzyl N-[1-[[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 122197352) has the molecular formula C36H44N4O5 and a molecular weight of 612.77 g/mol. Its IUPAC name is benzyl N-[1-[[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 122197352 |
| Molecular Formula | C36H44N4O5 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | benzyl N-[1-[[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)C(=O)NCCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C36H44N4O5/c1-26(2)23-31(39-36(44)45-25-28-15-7-4-8-16-28)34(42)38-30(24-27-13-5-3-6-14-27)33(41)35(43)37-20-12-22-40-21-11-18-29-17-9-10-19-32(29)40/h3-10,13-17,19,26,30-31H,11-12,18,20-25H2,1-2H3,(H,37,43)(H,38,42)(H,39,44) |
| InChIKey | JJAOOYMOIBDGJA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|