C21H25FN2O4S — CID 122197353
(Z)-7-[(1R,2R,5S)-2-fluoro-5-(quinolin-8-ylsulfonylamino)cyclopentyl]hept-5-enoic acid (PubChem CID 122197353) has the molecular formula C21H25FN2O4S and a molecular weight of 420.51 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-fluoro-5-(quinolin-8-ylsulfonylamino)cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-fluoro-5-(quinolin-8-ylsulfonylamino)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 122197353 |
| Molecular Formula | C21H25FN2O4S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-fluoro-5-(quinolin-8-ylsulfonylamino)cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@H](F)CC[C@@H]1NS(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C21H25FN2O4S/c22-17-12-13-18(16(17)9-3-1-2-4-11-20(25)26)24-29(27,28)19-10-5-7-15-8-6-14-23-21(15)19/h1,3,5-8,10,14,16-18,24H,2,4,9,11-13H2,(H,25,26)/b3-1-/t16-,17+,18-/m0/s1 |
| InChIKey | WQRIRZONRYDKCT-ALVNHBQLSA-N |
| XLogP | 3.83 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|