C28H39N5 — CID 122197504
(1S,9S,16R)-16,17-dimethyl-4,13-bis(4-methylpiperazin-1-yl)-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 122197504) has the molecular formula C28H39N5 and a molecular weight of 445.66 g/mol. Its IUPAC name is (1S,9S,16R)-16,17-dimethyl-4,13-bis(4-methylpiperazin-1-yl)-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | (1S,9S,16R)-16,17-dimethyl-4,13-bis(4-methylpiperazin-1-yl)-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 122197504 |
| Molecular Formula | C28H39N5 |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | (1S,9S,16R)-16,17-dimethyl-4,13-bis(4-methylpiperazin-1-yl)-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | C[C@@H]1[C@H]2c3cc(N4CCN(C)CC4)ccc3C[C@@H](c3ccc(N4CCN(C)CC4)cc32)N1C |
| InChI | InChI=1S/C28H39N5/c1-20-28-25-18-22(32-13-9-29(2)10-14-32)6-5-21(25)17-27(31(20)4)24-8-7-23(19-26(24)28)33-15-11-30(3)12-16-33/h5-8,18-20,27-28H,9-17H2,1-4H3/t20-,27+,28+/m1/s1 |
| InChIKey | GAHGDYKRJGEFCV-ANFLZCCJSA-N |
| XLogP | 3.25 |
| TPSA | 16.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|