C25H29Cl2N3O5 — CID 122197891
methyl 4-[3-[(4-chlorophenyl)methyl]-4-(3-chloro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3-diazinan-1-yl]butanoate (PubChem CID 122197891) has the molecular formula C25H29Cl2N3O5 and a molecular weight of 522.43 g/mol. Its IUPAC name is methyl 4-[3-[(4-chlorophenyl)methyl]-4-(3-chloro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3-diazinan-1-yl]butanoate.
| Compound Name | methyl 4-[3-[(4-chlorophenyl)methyl]-4-(3-chloro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3-diazinan-1-yl]butanoate |
|---|---|
| PubChem CID | 122197891 |
| Molecular Formula | C25H29Cl2N3O5 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | methyl 4-[3-[(4-chlorophenyl)methyl]-4-(3-chloro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3-diazinan-1-yl]butanoate |
| SMILES | COC(=O)CCCN1C(=O)CC(Nc2ccc(OC(C)C)c(Cl)c2)N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C25H29Cl2N3O5/c1-16(2)35-21-11-10-19(13-20(21)27)28-22-14-23(31)29(12-4-5-24(32)34-3)25(33)30(22)15-17-6-8-18(26)9-7-17/h6-11,13,16,22,28H,4-5,12,14-15H2,1-3H3 |
| InChIKey | MUROIMXBOPTQKQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|