About 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol
2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol (PubChem CID 122197912) has the molecular formula C22H17F3N2O2
and a molecular weight of 398.38 g/mol. Its IUPAC name is 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol.
Molecular Properties
| Compound Name | 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol |
| PubChem CID | 122197912 |
| Molecular Formula | C22H17F3N2O2 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol |
| SMILES | OCCc1cn(-c2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)c2cnccc12 |
| InChI | InChI=1S/C22H17F3N2O2/c23-22(24,25)16-1-5-18(6-2-16)29-19-7-3-17(4-8-19)27-14-15(10-12-28)20-9-11-26-13-21(20)27/h1-9,11,13-14,28H,10,12H2 |
| InChIKey | XIPHRCBPLUZGBV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol?
The IUPAC name of 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol (CID 122197912) is 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol.
What is the SMILES notation for 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol?
The canonical SMILES for 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol is OCCc1cn(-c2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)c2cnccc12.
What is the InChIKey of 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol?
The InChIKey is XIPHRCBPLUZGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F3N2O2/c23-22(24,25)16-1-5-18(6-2-16)29-19-7-3-17(4-8-19)27-14-15(10-12-28)20-9-11-26-13-21(20)27/h1-9,11,13-14,28H,10,12H2.
What are the key properties of 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol?
2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol has a molecular weight of 398.38 g/mol, XLogP of 5.37, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolo[2,3-c]pyridin-3-yl]ethanol is sourced from PubChem (CID 122197912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).