C21H20N2O7 — CID 122198284
(4S,4aS,12aR)-2-carbamoyl-10,11,12a-trihydroxy-6-methyl-4-(methylazaniumyl)-3,12-dioxo-4a,5-dihydro-4H-tetracen-1-olate (PubChem CID 122198284) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is (4S,4aS,12aR)-2-carbamoyl-10,11,12a-trihydroxy-6-methyl-4-(methylazaniumyl)-3,12-dioxo-4a,5-dihydro-4H-tetracen-1-olate.
| Compound Name | (4S,4aS,12aR)-2-carbamoyl-10,11,12a-trihydroxy-6-methyl-4-(methylazaniumyl)-3,12-dioxo-4a,5-dihydro-4H-tetracen-1-olate |
|---|---|
| PubChem CID | 122198284 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (4S,4aS,12aR)-2-carbamoyl-10,11,12a-trihydroxy-6-methyl-4-(methylazaniumyl)-3,12-dioxo-4a,5-dihydro-4H-tetracen-1-olate |
| SMILES | C[NH2+][C@@H]1C(=O)C(C(N)=O)=C([O-])[C@@]2(O)C(=O)c3c(c(C)c4cccc(O)c4c3O)C[C@@H]12 |
| InChI | InChI=1S/C21H20N2O7/c1-7-8-4-3-5-11(24)12(8)16(25)13-9(7)6-10-15(23-2)17(26)14(20(22)29)19(28)21(10,30)18(13)27/h3-5,10,15,23-25,28,30H,6H2,1-2H3,(H2,22,29)/t10-,15-,21-/m0/s1 |
| InChIKey | LJLCFQKDCDGSSK-QYAMTVPHSA-N |
| XLogP | -2.11 |
| TPSA | 177.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|