C23H20ClN5O4 — CID 122198673
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 1-(4-chlorophenyl)-5-(2-methylphenyl)pyrazole-3-carboxylate (PubChem CID 122198673) has the molecular formula C23H20ClN5O4 and a molecular weight of 465.90 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 1-(4-chlorophenyl)-5-(2-methylphenyl)pyrazole-3-carboxylate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 1-(4-chlorophenyl)-5-(2-methylphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 122198673 |
| Molecular Formula | C23H20ClN5O4 |
| Molecular Weight | 465.90 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 1-(4-chlorophenyl)-5-(2-methylphenyl)pyrazole-3-carboxylate |
| SMILES | Cc1ccccc1-c1cc(C(=O)OCCn2c([N+](=O)[O-])cnc2C)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN5O4/c1-15-5-3-4-6-19(15)21-13-20(26-28(21)18-9-7-17(24)8-10-18)23(30)33-12-11-27-16(2)25-14-22(27)29(31)32/h3-10,13-14H,11-12H2,1-2H3 |
| InChIKey | PDTUAEDDMFXXHY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 105.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|