C23H31FN2O5 — CID 122198725
methyl (E)-2-(3-ethyl-9-fluoro-7a-hydroxy-8-methoxy-2,3,4,6,7,12,12a,12b-octahydro-1H-indolo[2,3-a]quinolizin-2-yl)-3-methoxyprop-2-enoate (PubChem CID 122198725) has the molecular formula C23H31FN2O5 and a molecular weight of 434.51 g/mol. Its IUPAC name is methyl (E)-2-(3-ethyl-9-fluoro-7a-hydroxy-8-methoxy-2,3,4,6,7,12,12a,12b-octahydro-1H-indolo[2,3-a]quinolizin-2-yl)-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-(3-ethyl-9-fluoro-7a-hydroxy-8-methoxy-2,3,4,6,7,12,12a,12b-octahydro-1H-indolo[2,3-a]quinolizin-2-yl)-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 122198725 |
| Molecular Formula | C23H31FN2O5 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | methyl (E)-2-(3-ethyl-9-fluoro-7a-hydroxy-8-methoxy-2,3,4,6,7,12,12a,12b-octahydro-1H-indolo[2,3-a]quinolizin-2-yl)-3-methoxyprop-2-enoate |
| SMILES | CCC1CN2CCC3(O)c4c(ccc(F)c4OC)NC3C2CC1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C23H31FN2O5/c1-5-13-11-26-9-8-23(28)19-17(7-6-16(24)20(19)30-3)25-21(23)18(26)10-14(13)15(12-29-2)22(27)31-4/h6-7,12-14,18,21,25,28H,5,8-11H2,1-4H3/b15-12+ |
| InChIKey | DKMVCOVCNPWGTO-NTCAYCPXSA-N |
| XLogP | 2.64 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|