(2E)-2-(2,2-dimethylcyclopropylidene)acetic acid

C7H10O2 — CID 122199254

IUPAC(2E)-2-(2,2-dimethylcyclopropylidene)acetic acid
SMILESCC1(C)C/C1=C\C(=O)O
InChIInChI=1S/C7H10O2/c1-7(2)4-5(7)3-6(8)9/h3H,4H2,1-2H3,(H,8,9)/b5-3+
InChIKeyACWBTDGEHKYBTK-HWKANZROSA-N
MW126.15 g/mol
LogP1.43
Rot. Bonds1

About (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid

(2E)-2-(2,2-dimethylcyclopropylidene)acetic acid (PubChem CID 122199254) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid.

Molecular Properties

Compound Name(2E)-2-(2,2-dimethylcyclopropylidene)acetic acid
PubChem CID122199254
Molecular FormulaC7H10O2
Molecular Weight126.15 g/mol
Exact Mass126.07
IUPAC Name(2E)-2-(2,2-dimethylcyclopropylidene)acetic acid
SMILESCC1(C)C/C1=C\C(=O)O
InChIInChI=1S/C7H10O2/c1-7(2)4-5(7)3-6(8)9/h3H,4H2,1-2H3,(H,8,9)/b5-3+
InChIKeyACWBTDGEHKYBTK-HWKANZROSA-N
XLogP1.43
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.15
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid?
The IUPAC name of (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid (CID 122199254) is (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid.
What is the SMILES notation for (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid?
The canonical SMILES for (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid is CC1(C)C/C1=C\C(=O)O.
What is the InChIKey of (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid?
The InChIKey is ACWBTDGEHKYBTK-HWKANZROSA-N. The full InChI is InChI=1S/C7H10O2/c1-7(2)4-5(7)3-6(8)9/h3H,4H2,1-2H3,(H,8,9)/b5-3+.
What are the key properties of (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid?
(2E)-2-(2,2-dimethylcyclopropylidene)acetic acid has a molecular weight of 126.15 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(2,2-dimethylcyclopropylidene)acetic acid is sourced from PubChem (CID 122199254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).