C9H11ClF3NO2 — CID 122199367
2-amino-1-[3-(trifluoromethoxy)phenyl]ethanol;hydrochloride (PubChem CID 122199367) has the molecular formula C9H11ClF3NO2 and a molecular weight of 257.64 g/mol. Its IUPAC name is 2-amino-1-[3-(trifluoromethoxy)phenyl]ethanol;hydrochloride.
| Compound Name | 2-amino-1-[3-(trifluoromethoxy)phenyl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 122199367 |
| Molecular Formula | C9H11ClF3NO2 |
| Molecular Weight | 257.64 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-amino-1-[3-(trifluoromethoxy)phenyl]ethanol;hydrochloride |
| SMILES | Cl.NCC(O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C9H10F3NO2.ClH/c10-9(11,12)15-7-3-1-2-6(4-7)8(14)5-13;/h1-4,8,14H,5,13H2;1H |
| InChIKey | ZZKNFHYMXMNTDJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.64 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |