About 1,2,4-trichlorocyclopenta-1,3-diene
1,2,4-trichlorocyclopenta-1,3-diene (PubChem CID 122201414) has the molecular formula C5H3Cl3
and a molecular weight of 169.44 g/mol. Its IUPAC name is 1,2,4-trichlorocyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 1,2,4-trichlorocyclopenta-1,3-diene |
| PubChem CID | 122201414 |
| Molecular Formula | C5H3Cl3 |
| Molecular Weight | 169.44 g/mol |
| Exact Mass | 167.93 |
| IUPAC Name | 1,2,4-trichlorocyclopenta-1,3-diene |
| SMILES | ClC1=CC(Cl)=C(Cl)C1 |
| InChI | InChI=1S/C5H3Cl3/c6-3-1-4(7)5(8)2-3/h1H,2H2 |
| InChIKey | VKXIAKIRELCMLU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2,4-trichlorocyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trichlorocyclopenta-1,3-diene?
The IUPAC name of 1,2,4-trichlorocyclopenta-1,3-diene (CID 122201414) is 1,2,4-trichlorocyclopenta-1,3-diene.
What is the SMILES notation for 1,2,4-trichlorocyclopenta-1,3-diene?
The canonical SMILES for 1,2,4-trichlorocyclopenta-1,3-diene is ClC1=CC(Cl)=C(Cl)C1.
What is the InChIKey of 1,2,4-trichlorocyclopenta-1,3-diene?
The InChIKey is VKXIAKIRELCMLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl3/c6-3-1-4(7)5(8)2-3/h1H,2H2.
What are the key properties of 1,2,4-trichlorocyclopenta-1,3-diene?
1,2,4-trichlorocyclopenta-1,3-diene has a molecular weight of 169.44 g/mol, XLogP of 3.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trichlorocyclopenta-1,3-diene is sourced from PubChem (CID 122201414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).