C33H29NO2S — CID 122201832
6,8-dimethyl-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-2,3-dihydrobenzo[g]indole (PubChem CID 122201832) has the molecular formula C33H29NO2S and a molecular weight of 503.67 g/mol. Its IUPAC name is 6,8-dimethyl-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-2,3-dihydrobenzo[g]indole.
| Compound Name | 6,8-dimethyl-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-2,3-dihydrobenzo[g]indole |
|---|---|
| PubChem CID | 122201832 |
| Molecular Formula | C33H29NO2S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 6,8-dimethyl-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-2,3-dihydrobenzo[g]indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3c(-c4ccccc4)c(-c4ccccc4)c4c(C)cc(C)cc4c32)cc1 |
| InChI | InChI=1S/C33H29NO2S/c1-22-14-16-27(17-15-22)37(35,36)34-19-18-28-31(25-10-6-4-7-11-25)32(26-12-8-5-9-13-26)30-24(3)20-23(2)21-29(30)33(28)34/h4-17,20-21H,18-19H2,1-3H3 |
| InChIKey | HJAAZTQVXIZZPL-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |