C37H29NO2S — CID 122201833
1-(4-methylphenyl)sulfonyl-2,4,5-triphenyl-2,3-dihydrobenzo[g]indole (PubChem CID 122201833) has the molecular formula C37H29NO2S and a molecular weight of 551.71 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2,4,5-triphenyl-2,3-dihydrobenzo[g]indole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2,4,5-triphenyl-2,3-dihydrobenzo[g]indole |
|---|---|
| PubChem CID | 122201833 |
| Molecular Formula | C37H29NO2S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2,4,5-triphenyl-2,3-dihydrobenzo[g]indole |
| SMILES | Cc1ccc(S(=O)(=O)N2c3c(c(-c4ccccc4)c(-c4ccccc4)c4ccccc34)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C37H29NO2S/c1-26-21-23-30(24-22-26)41(39,40)38-34(27-13-5-2-6-14-27)25-33-36(29-17-9-4-10-18-29)35(28-15-7-3-8-16-28)31-19-11-12-20-32(31)37(33)38/h2-24,34H,25H2,1H3 |
| InChIKey | FCMAPGQTRNIEPJ-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |