About 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one
2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one (PubChem CID 122201931) has the molecular formula C16H17N3O2S
and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one |
| PubChem CID | 122201931 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1cc(C)n(C(=O)CC2Sc3cccc(C)c3NC2=O)n1 |
| InChI | InChI=1S/C16H17N3O2S/c1-9-5-4-6-12-15(9)17-16(21)13(22-12)8-14(20)19-11(3)7-10(2)18-19/h4-7,13H,8H2,1-3H3,(H,17,21) |
| InChIKey | XKYVLIUEIDYLBD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one?
The IUPAC name of 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one (CID 122201931) is 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one is Cc1cc(C)n(C(=O)CC2Sc3cccc(C)c3NC2=O)n1.
What is the InChIKey of 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one?
The InChIKey is XKYVLIUEIDYLBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2S/c1-9-5-4-6-12-15(9)17-16(21)13(22-12)8-14(20)19-11(3)7-10(2)18-19/h4-7,13H,8H2,1-3H3,(H,17,21).
What are the key properties of 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one?
2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one has a molecular weight of 315.40 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]-5-methyl-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 122201931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).