C20H18F4 — CID 122202281
1,2,4,5-tetrafluoro-3-octa-1,7-dien-3-yl-6-phenylbenzene (PubChem CID 122202281) has the molecular formula C20H18F4 and a molecular weight of 334.36 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-octa-1,7-dien-3-yl-6-phenylbenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-octa-1,7-dien-3-yl-6-phenylbenzene |
|---|---|
| PubChem CID | 122202281 |
| Molecular Formula | C20H18F4 |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-octa-1,7-dien-3-yl-6-phenylbenzene |
| SMILES | C=CCCCC(C=C)c1c(F)c(F)c(-c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C20H18F4/c1-3-5-7-10-13(4-2)15-17(21)19(23)16(20(24)18(15)22)14-11-8-6-9-12-14/h3-4,6,8-9,11-13H,1-2,5,7,10H2 |
| InChIKey | BDLKJZXTHAYVSV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|