C23H19N3O2 — CID 122202526
tert-butyl 2,10,12-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene-10-carboxylate (PubChem CID 122202526) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is tert-butyl 2,10,12-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene-10-carboxylate.
| Compound Name | tert-butyl 2,10,12-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene-10-carboxylate |
|---|---|
| PubChem CID | 122202526 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | tert-butyl 2,10,12-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2ccccc2c2nc3cc4ccccc4cc3nc21 |
| InChI | InChI=1S/C23H19N3O2/c1-23(2,3)28-22(27)26-19-11-7-6-10-16(19)20-21(26)25-18-13-15-9-5-4-8-14(15)12-17(18)24-20/h4-13H,1-3H3 |
| InChIKey | DKTLRBULLOAOLG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|