About (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone
(2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone (PubChem CID 122202756) has the molecular formula C17H13NO2
and a molecular weight of 263.30 g/mol. Its IUPAC name is (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone |
| PubChem CID | 122202756 |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone |
| SMILES | Cc1nc(-c2ccccc2)c(C(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C17H13NO2/c1-12-18-15(13-8-4-2-5-9-13)17(20-12)16(19)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | GNRDFMSBYXYOBB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone?
The IUPAC name of (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone (CID 122202756) is (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone.
What is the SMILES notation for (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone?
The canonical SMILES for (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone is Cc1nc(-c2ccccc2)c(C(=O)c2ccccc2)o1.
What is the InChIKey of (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone?
The InChIKey is GNRDFMSBYXYOBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2/c1-12-18-15(13-8-4-2-5-9-13)17(20-12)16(19)14-10-6-3-7-11-14/h2-11H,1H3.
What are the key properties of (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone?
(2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone has a molecular weight of 263.30 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4-phenyl-1,3-oxazol-5-yl)-phenylmethanone is sourced from PubChem (CID 122202756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).