C17H12Br3F3O3S — CID 122203246
(11,13,15-tribromo-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl) trifluoromethanesulfonate (PubChem CID 122203246) has the molecular formula C17H12Br3F3O3S and a molecular weight of 593.05 g/mol. Its IUPAC name is (11,13,15-tribromo-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl) trifluoromethanesulfonate.
| Compound Name | (11,13,15-tribromo-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122203246 |
| Molecular Formula | C17H12Br3F3O3S |
| Molecular Weight | 593.05 g/mol |
| Exact Mass | 589.80 |
| IUPAC Name | (11,13,15-tribromo-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c(Br)cc1CCc1cc(Br)c(cc1Br)CC2)C(F)(F)F |
| InChI | InChI=1S/C17H12Br3F3O3S/c18-13-6-10-3-4-12-7-15(20)11(2-1-9(13)5-14(10)19)8-16(12)26-27(24,25)17(21,22)23/h5-8H,1-4H2 |
| InChIKey | DBHDOZVCHZJGQK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.05 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|