C20H23ClO — CID 122205368
(2S,2aS,2bR,7aR)-2-(2-chlorophenyl)-2b,6,6-trimethyl-2,2a,3,4,5,7a-hexahydrocyclobuta[a]inden-1-one (PubChem CID 122205368) has the molecular formula C20H23ClO and a molecular weight of 314.86 g/mol. Its IUPAC name is (2S,2aS,2bR,7aR)-2-(2-chlorophenyl)-2b,6,6-trimethyl-2,2a,3,4,5,7a-hexahydrocyclobuta[a]inden-1-one.
| Compound Name | (2S,2aS,2bR,7aR)-2-(2-chlorophenyl)-2b,6,6-trimethyl-2,2a,3,4,5,7a-hexahydrocyclobuta[a]inden-1-one |
|---|---|
| PubChem CID | 122205368 |
| Molecular Formula | C20H23ClO |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2S,2aS,2bR,7aR)-2-(2-chlorophenyl)-2b,6,6-trimethyl-2,2a,3,4,5,7a-hexahydrocyclobuta[a]inden-1-one |
| SMILES | CC1(C)CCC[C@@]2(C)C1=C[C@H]1C(=O)[C@H](c3ccccc3Cl)[C@H]12 |
| InChI | InChI=1S/C20H23ClO/c1-19(2)9-6-10-20(3)15(19)11-13-17(20)16(18(13)22)12-7-4-5-8-14(12)21/h4-5,7-8,11,13,16-17H,6,9-10H2,1-3H3/t13-,16-,17+,20+/m1/s1 |
| InChIKey | NCRHUPLMLPIJQM-JPUXWFAOSA-N |
| XLogP | 5.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|