C21H26O2 — CID 122205374
(1S,3aR,8aR,8bR)-5,5,8a-trimethyl-1-(2-methylphenyl)-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-3-one (PubChem CID 122205374) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (1S,3aR,8aR,8bR)-5,5,8a-trimethyl-1-(2-methylphenyl)-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-3-one.
| Compound Name | (1S,3aR,8aR,8bR)-5,5,8a-trimethyl-1-(2-methylphenyl)-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-3-one |
|---|---|
| PubChem CID | 122205374 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (1S,3aR,8aR,8bR)-5,5,8a-trimethyl-1-(2-methylphenyl)-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-3-one |
| SMILES | Cc1ccccc1[C@H]1OC(=O)[C@@H]2C=C3C(C)(C)CCC[C@]3(C)[C@H]12 |
| InChI | InChI=1S/C21H26O2/c1-13-8-5-6-9-14(13)18-17-15(19(22)23-18)12-16-20(2,3)10-7-11-21(16,17)4/h5-6,8-9,12,15,17-18H,7,10-11H2,1-4H3/t15-,17+,18-,21+/m1/s1 |
| InChIKey | KJZQERCWNADWFE-HVSHLEFESA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|