C21H17N3O3S — CID 122205415
N-[6-(3,4-dimethoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]benzamide (PubChem CID 122205415) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[6-(3,4-dimethoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]benzamide.
| Compound Name | N-[6-(3,4-dimethoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 122205415 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[6-(3,4-dimethoxyphenyl)-[1,2]thiazolo[4,3-b]pyridin-3-yl]benzamide |
| SMILES | COc1ccc(-c2cnc3c(NC(=O)c4ccccc4)snc3c2)cc1OC |
| InChI | InChI=1S/C21H17N3O3S/c1-26-17-9-8-14(11-18(17)27-2)15-10-16-19(22-12-15)21(28-24-16)23-20(25)13-6-4-3-5-7-13/h3-12H,1-2H3,(H,23,25) |
| InChIKey | HUVNXBZVUCRXTO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |