C13H19Br3O4 — CID 122205453
[(2S,3R,6S)-6-[3-bromo-2,2-bis(bromomethyl)propoxy]-2-methyl-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 122205453) has the molecular formula C13H19Br3O4 and a molecular weight of 479.00 g/mol. Its IUPAC name is [(2S,3R,6S)-6-[3-bromo-2,2-bis(bromomethyl)propoxy]-2-methyl-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(2S,3R,6S)-6-[3-bromo-2,2-bis(bromomethyl)propoxy]-2-methyl-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 122205453 |
| Molecular Formula | C13H19Br3O4 |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 475.88 |
| IUPAC Name | [(2S,3R,6S)-6-[3-bromo-2,2-bis(bromomethyl)propoxy]-2-methyl-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@@H](OCC(CBr)(CBr)CBr)O[C@H]1C |
| InChI | InChI=1S/C13H19Br3O4/c1-9-11(20-10(2)17)3-4-12(19-9)18-8-13(5-14,6-15)7-16/h3-4,9,11-12H,5-8H2,1-2H3/t9-,11+,12-/m0/s1 |
| InChIKey | AWJZNAADXQVFIQ-WCQGTBRESA-N |
| XLogP | 3.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|