C26H20N2O5S — CID 122205459
(3R,4S)-2-(4-methylphenyl)sulfonyl-3-naphthalen-1-yl-4-nitro-3,4-dihydroisoquinolin-1-one (PubChem CID 122205459) has the molecular formula C26H20N2O5S and a molecular weight of 472.52 g/mol. Its IUPAC name is (3R,4S)-2-(4-methylphenyl)sulfonyl-3-naphthalen-1-yl-4-nitro-3,4-dihydroisoquinolin-1-one.
| Compound Name | (3R,4S)-2-(4-methylphenyl)sulfonyl-3-naphthalen-1-yl-4-nitro-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 122205459 |
| Molecular Formula | C26H20N2O5S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | (3R,4S)-2-(4-methylphenyl)sulfonyl-3-naphthalen-1-yl-4-nitro-3,4-dihydroisoquinolin-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)c3ccccc3[C@H]([N+](=O)[O-])[C@H]2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H20N2O5S/c1-17-13-15-19(16-14-17)34(32,33)27-24(21-12-6-8-18-7-2-3-9-20(18)21)25(28(30)31)22-10-4-5-11-23(22)26(27)29/h2-16,24-25H,1H3/t24-,25+/m1/s1 |
| InChIKey | LISUUIBIUOVOJT-RPBOFIJWSA-N |
| XLogP | 5.05 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|