About 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one
4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one (PubChem CID 122205561) has the molecular formula C20H17N3O
and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one |
| PubChem CID | 122205561 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one |
| SMILES | Cc1ccc2nc3c(cc2c1)c(N)cc(=O)n3Cc1ccccc1 |
| InChI | InChI=1S/C20H17N3O/c1-13-7-8-18-15(9-13)10-16-17(21)11-19(24)23(20(16)22-18)12-14-5-3-2-4-6-14/h2-11H,12,21H2,1H3 |
| InChIKey | CYWHKHYHQFVDQA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one?
The IUPAC name of 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one (CID 122205561) is 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one.
What is the SMILES notation for 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one?
The canonical SMILES for 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one is Cc1ccc2nc3c(cc2c1)c(N)cc(=O)n3Cc1ccccc1.
What is the InChIKey of 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one?
The InChIKey is CYWHKHYHQFVDQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O/c1-13-7-8-18-15(9-13)10-16-17(21)11-19(24)23(20(16)22-18)12-14-5-3-2-4-6-14/h2-11H,12,21H2,1H3.
What are the key properties of 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one?
4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one has a molecular weight of 315.38 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-benzyl-7-methylbenzo[b][1,8]naphthyridin-2-one is sourced from PubChem (CID 122205561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).