About [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone
[5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone (PubChem CID 122205660) has the molecular formula C16H11F3N2O
and a molecular weight of 304.27 g/mol. Its IUPAC name is [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone |
| PubChem CID | 122205660 |
| Molecular Formula | C16H11F3N2O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)n1nc(C(F)(F)F)cc1C1=CC=CC1 |
| InChI | InChI=1S/C16H11F3N2O/c17-16(18,19)14-10-13(11-6-4-5-7-11)21(20-14)15(22)12-8-2-1-3-9-12/h1-6,8-10H,7H2 |
| InChIKey | FDVXEPLBDCXIAQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone?
The IUPAC name of [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone (CID 122205660) is [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone.
What is the SMILES notation for [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone?
The canonical SMILES for [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone is O=C(c1ccccc1)n1nc(C(F)(F)F)cc1C1=CC=CC1.
What is the InChIKey of [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone?
The InChIKey is FDVXEPLBDCXIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3N2O/c17-16(18,19)14-10-13(11-6-4-5-7-11)21(20-14)15(22)12-8-2-1-3-9-12/h1-6,8-10H,7H2.
What are the key properties of [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone?
[5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone has a molecular weight of 304.27 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-cyclopenta-1,3-dien-1-yl-3-(trifluoromethyl)pyrazol-1-yl]-phenylmethanone is sourced from PubChem (CID 122205660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).