C15H21NO4S2 — CID 122206049
diethyl 2-cyclohexyl-3-sulfanylidene-1,2-thiazole-4,5-dicarboxylate (PubChem CID 122206049) has the molecular formula C15H21NO4S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is diethyl 2-cyclohexyl-3-sulfanylidene-1,2-thiazole-4,5-dicarboxylate.
| Compound Name | diethyl 2-cyclohexyl-3-sulfanylidene-1,2-thiazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 122206049 |
| Molecular Formula | C15H21NO4S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | diethyl 2-cyclohexyl-3-sulfanylidene-1,2-thiazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1sn(C2CCCCC2)c(=S)c1C(=O)OCC |
| InChI | InChI=1S/C15H21NO4S2/c1-3-19-14(17)11-12(15(18)20-4-2)22-16(13(11)21)10-8-6-5-7-9-10/h10H,3-9H2,1-2H3 |
| InChIKey | DMZNGAFKNNARQO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|