C35H26O6 — CID 122206276
1-hydroxy-4,5,8-tris(4-methoxyphenyl)anthracene-9,10-dione (PubChem CID 122206276) has the molecular formula C35H26O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is 1-hydroxy-4,5,8-tris(4-methoxyphenyl)anthracene-9,10-dione.
| Compound Name | 1-hydroxy-4,5,8-tris(4-methoxyphenyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 122206276 |
| Molecular Formula | C35H26O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 1-hydroxy-4,5,8-tris(4-methoxyphenyl)anthracene-9,10-dione |
| SMILES | COc1ccc(-c2ccc(O)c3c2C(=O)c2c(-c4ccc(OC)cc4)ccc(-c4ccc(OC)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C35H26O6/c1-39-23-10-4-20(5-11-23)26-16-17-27(21-6-12-24(40-2)13-7-21)31-30(26)34(37)32-28(18-19-29(36)33(32)35(31)38)22-8-14-25(41-3)15-9-22/h4-19,36H,1-3H3 |
| InChIKey | WKCRVFWUYNKMGD-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|